C23H27FN2O2 — CID 121499628
[4-(4-fluoro-2-hydroxyphenyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone (PubChem CID 121499628) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is [4-(4-fluoro-2-hydroxyphenyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(4-fluoro-2-hydroxyphenyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121499628 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [4-(4-fluoro-2-hydroxyphenyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(F)cc2O)cc1)N1CCCCC1CN1CCCC1 |
| InChI | InChI=1S/C23H27FN2O2/c24-19-10-11-21(22(27)15-19)17-6-8-18(9-7-17)23(28)26-14-2-1-5-20(26)16-25-12-3-4-13-25/h6-11,15,20,27H,1-5,12-14,16H2 |
| InChIKey | ASUIRLINIAMJBO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |