C11H15F2N3O2 — CID 121495779
5-(difluoromethyl)-N-[2-(oxolan-3-yl)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 121495779) has the molecular formula C11H15F2N3O2 and a molecular weight of 259.26 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-[2-(oxolan-3-yl)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(difluoromethyl)-N-[2-(oxolan-3-yl)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 121495779 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 5-(difluoromethyl)-N-[2-(oxolan-3-yl)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCCC1CCOC1)c1cc(C(F)F)[nH]n1 |
| InChI | InChI=1S/C11H15F2N3O2/c12-10(13)8-5-9(16-15-8)11(17)14-3-1-7-2-4-18-6-7/h5,7,10H,1-4,6H2,(H,14,17)(H,15,16) |
| InChIKey | JFXRPWPWUXTTPI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |