C12H19N3O4S — CID 99704181
N-[[(3R)-oxolan-3-yl]methylsulfonyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 99704181) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[[(3R)-oxolan-3-yl]methylsulfonyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[[(3R)-oxolan-3-yl]methylsulfonyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 99704181 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[[(3R)-oxolan-3-yl]methylsulfonyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NS(=O)(=O)C[C@@H]2CCOC2)n[nH]1 |
| InChI | InChI=1S/C12H19N3O4S/c1-8(2)10-5-11(14-13-10)12(16)15-20(17,18)7-9-3-4-19-6-9/h5,8-9H,3-4,6-7H2,1-2H3,(H,13,14)(H,15,16)/t9-/m1/s1 |
| InChIKey | JPAVLSGXIXRXMX-SECBINFHSA-N |
| XLogP | 0.63 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |