C22H27N5O — CID 121496739
N-(3-indazol-1-ylpropyl)-4-phenyl-1,4-diazepane-1-carboxamide (PubChem CID 121496739) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(3-indazol-1-ylpropyl)-4-phenyl-1,4-diazepane-1-carboxamide.
| Compound Name | N-(3-indazol-1-ylpropyl)-4-phenyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 121496739 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-(3-indazol-1-ylpropyl)-4-phenyl-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCCCn1ncc2ccccc21)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N5O/c28-22(23-12-6-15-27-21-11-5-4-8-19(21)18-24-27)26-14-7-13-25(16-17-26)20-9-2-1-3-10-20/h1-5,8-11,18H,6-7,12-17H2,(H,23,28) |
| InChIKey | GKLRUTNIFYZBIN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|