C18H27ClN4O2 — CID 121498779
4-(5-chloro-2-pyridinyl)-N-[4-(oxolan-2-yl)butyl]piperazine-1-carboxamide (PubChem CID 121498779) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-N-[4-(oxolan-2-yl)butyl]piperazine-1-carboxamide.
| Compound Name | 4-(5-chloro-2-pyridinyl)-N-[4-(oxolan-2-yl)butyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 121498779 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-N-[4-(oxolan-2-yl)butyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCCCC1CCCO1)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C18H27ClN4O2/c19-15-6-7-17(21-14-15)22-9-11-23(12-10-22)18(24)20-8-2-1-4-16-5-3-13-25-16/h6-7,14,16H,1-5,8-13H2,(H,20,24) |
| InChIKey | OILKFOHHCHAZBH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|