C12H13ClN4O — CID 121499652
4-chloro-5-methyl-N-(2-pyridin-4-ylethyl)-1H-pyrazole-3-carboxamide (PubChem CID 121499652) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is 4-chloro-5-methyl-N-(2-pyridin-4-ylethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-5-methyl-N-(2-pyridin-4-ylethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 121499652 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-chloro-5-methyl-N-(2-pyridin-4-ylethyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCCc2ccncc2)c1Cl |
| InChI | InChI=1S/C12H13ClN4O/c1-8-10(13)11(17-16-8)12(18)15-7-4-9-2-5-14-6-3-9/h2-3,5-6H,4,7H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | WGJCWPBYWLCBRY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |