C15H12Cl2N2O3 — CID 1089157
4,5-dichloro-2-(2-pyridin-4-ylethylcarbamoyl)benzoic acid (PubChem CID 1089157) has the molecular formula C15H12Cl2N2O3 and a molecular weight of 339.18 g/mol. Its IUPAC name is 4,5-dichloro-2-(2-pyridin-4-ylethylcarbamoyl)benzoic acid.
| Compound Name | 4,5-dichloro-2-(2-pyridin-4-ylethylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 1089157 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4,5-dichloro-2-(2-pyridin-4-ylethylcarbamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1C(=O)NCCc1ccncc1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c16-12-7-10(11(15(21)22)8-13(12)17)14(20)19-6-3-9-1-4-18-5-2-9/h1-2,4-5,7-8H,3,6H2,(H,19,20)(H,21,22) |
| InChIKey | JCYZKLPXNJETTO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |