C26H21ClN2O — CID 58791112
4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-4-ylethyl)benzamide (PubChem CID 58791112) has the molecular formula C26H21ClN2O and a molecular weight of 412.92 g/mol. Its IUPAC name is 4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-4-ylethyl)benzamide.
| Compound Name | 4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 58791112 |
| Molecular Formula | C26H21ClN2O |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-4-ylethyl)benzamide |
| SMILES | O=C(NCCc1ccncc1)c1ccc(Cl)c(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H21ClN2O/c27-25-11-10-23(26(30)29-17-14-19-12-15-28-16-13-19)18-24(25)22-8-6-21(7-9-22)20-4-2-1-3-5-20/h1-13,15-16,18H,14,17H2,(H,29,30) |
| InChIKey | ZWDBDVLVYLOGEV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |