C31H31ClN2O — CID 143191288
4-chloro-N-ethyl-3-(4-phenylphenyl)-N-(5-pyridin-4-ylpentyl)benzamide (PubChem CID 143191288) has the molecular formula C31H31ClN2O and a molecular weight of 483.06 g/mol. Its IUPAC name is 4-chloro-N-ethyl-3-(4-phenylphenyl)-N-(5-pyridin-4-ylpentyl)benzamide.
| Compound Name | 4-chloro-N-ethyl-3-(4-phenylphenyl)-N-(5-pyridin-4-ylpentyl)benzamide |
|---|---|
| PubChem CID | 143191288 |
| Molecular Formula | C31H31ClN2O |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 4-chloro-N-ethyl-3-(4-phenylphenyl)-N-(5-pyridin-4-ylpentyl)benzamide |
| SMILES | CCN(CCCCCc1ccncc1)C(=O)c1ccc(Cl)c(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C31H31ClN2O/c1-2-34(22-8-4-5-9-24-18-20-33-21-19-24)31(35)28-16-17-30(32)29(23-28)27-14-12-26(13-15-27)25-10-6-3-7-11-25/h3,6-7,10-21,23H,2,4-5,8-9,22H2,1H3 |
| InChIKey | ZXATWVWUJWDFPI-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|