C16H20N4O — CID 82183845
3,4-diamino-N-ethyl-N-(2-pyridin-4-ylethyl)benzamide (PubChem CID 82183845) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 3,4-diamino-N-ethyl-N-(2-pyridin-4-ylethyl)benzamide.
| Compound Name | 3,4-diamino-N-ethyl-N-(2-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 82183845 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3,4-diamino-N-ethyl-N-(2-pyridin-4-ylethyl)benzamide |
| SMILES | CCN(CCc1ccncc1)C(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C16H20N4O/c1-2-20(10-7-12-5-8-19-9-6-12)16(21)13-3-4-14(17)15(18)11-13/h3-6,8-9,11H,2,7,10,17-18H2,1H3 |
| InChIKey | VMYAOLZNFOYMKT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|