C30H28ClN3O — CID 58791104
4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-3-yl-2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 58791104) has the molecular formula C30H28ClN3O and a molecular weight of 482.03 g/mol. Its IUPAC name is 4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-3-yl-2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-3-yl-2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 58791104 |
| Molecular Formula | C30H28ClN3O |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 4-chloro-3-(4-phenylphenyl)-N-(2-pyridin-3-yl-2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NCC(c1cccnc1)N1CCCC1)c1ccc(Cl)c(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H28ClN3O/c31-28-15-14-25(19-27(28)24-12-10-23(11-13-24)22-7-2-1-3-8-22)30(35)33-21-29(34-17-4-5-18-34)26-9-6-16-32-20-26/h1-3,6-16,19-20,29H,4-5,17-18,21H2,(H,33,35) |
| InChIKey | XBKYFKCWEYSQHW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |