About furan-2-ylmethyl acetate
furan-2-ylmethyl acetate (PubChem CID 12170) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is furan-2-ylmethyl acetate.
Molecular Properties
| Compound Name | furan-2-ylmethyl acetate |
| PubChem CID | 12170 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | furan-2-ylmethyl acetate |
| SMILES | CC(=O)OCc1ccco1 |
| InChI | InChI=1S/C7H8O3/c1-6(8)10-5-7-3-2-4-9-7/h2-4H,5H2,1H3 |
| InChIKey | CKOYRRWBOKMNRG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-2-ylmethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl acetate?
The IUPAC name of furan-2-ylmethyl acetate (CID 12170) is furan-2-ylmethyl acetate.
What is the SMILES notation for furan-2-ylmethyl acetate?
The canonical SMILES for furan-2-ylmethyl acetate is CC(=O)OCc1ccco1.
What is the InChIKey of furan-2-ylmethyl acetate?
The InChIKey is CKOYRRWBOKMNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-6(8)10-5-7-3-2-4-9-7/h2-4H,5H2,1H3.
What are the key properties of furan-2-ylmethyl acetate?
furan-2-ylmethyl acetate has a molecular weight of 140.14 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl acetate is sourced from PubChem (CID 12170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).