C22H14FNO4 — CID 1217719
2-[2-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]isoindole-1,3-dione (PubChem CID 1217719) has the molecular formula C22H14FNO4 and a molecular weight of 375.36 g/mol. Its IUPAC name is 2-[2-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1217719 |
| Molecular Formula | C22H14FNO4 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[2-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]isoindole-1,3-dione |
| SMILES | O=C(COc1ccccc1N1C(=O)c2ccccc2C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H14FNO4/c23-15-11-9-14(10-12-15)19(25)13-28-20-8-4-3-7-18(20)24-21(26)16-5-1-2-6-17(16)22(24)27/h1-12H,13H2 |
| InChIKey | KPWRYCZHFKMDAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|