C16H24N2O5 — CID 122002239
3-[(3-ethoxy-4-methoxyphenyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122002239) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[(3-ethoxy-4-methoxyphenyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(3-ethoxy-4-methoxyphenyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122002239 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[(3-ethoxy-4-methoxyphenyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CCOc1cc(CNC(=O)N(C)CC(C)C(=O)O)ccc1OC |
| InChI | InChI=1S/C16H24N2O5/c1-5-23-14-8-12(6-7-13(14)22-4)9-17-16(21)18(3)10-11(2)15(19)20/h6-8,11H,5,9-10H2,1-4H3,(H,17,21)(H,19,20) |
| InChIKey | GZLAANAVICGFCJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |