C13H19N3O4 — CID 62994020
3-[(2-methoxy-4-pyridinyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 62994020) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[(2-methoxy-4-pyridinyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(2-methoxy-4-pyridinyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62994020 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-[(2-methoxy-4-pyridinyl)methylcarbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | COc1cc(CNC(=O)N(C)CC(C)C(=O)O)ccn1 |
| InChI | InChI=1S/C13H19N3O4/c1-9(12(17)18)8-16(2)13(19)15-7-10-4-5-14-11(6-10)20-3/h4-6,9H,7-8H2,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | UZHSWGZECIAEDH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |