C17H20ClFN2O3 — CID 122002838
(3aS,6aR)-2-[1-(2-chloro-4-fluorophenyl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122002838) has the molecular formula C17H20ClFN2O3 and a molecular weight of 354.81 g/mol. Its IUPAC name is (3aS,6aR)-2-[1-(2-chloro-4-fluorophenyl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[1-(2-chloro-4-fluorophenyl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122002838 |
| Molecular Formula | C17H20ClFN2O3 |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (3aS,6aR)-2-[1-(2-chloro-4-fluorophenyl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CC(NC(=O)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H20ClFN2O3/c1-10(13-5-4-12(19)7-14(13)18)20-16(24)21-8-11-3-2-6-17(11,9-21)15(22)23/h4-5,7,10-11H,2-3,6,8-9H2,1H3,(H,20,24)(H,22,23)/t10?,11-,17+/m0/s1 |
| InChIKey | NUNSVUSDFGTRDF-SMDAVRNZSA-N |
| XLogP | 3.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |