C17H19F3N2O3S — CID 122085155
(3aS,6aR)-2-[[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122085155) has the molecular formula C17H19F3N2O3S and a molecular weight of 388.41 g/mol. Its IUPAC name is (3aS,6aR)-2-[[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122085155 |
| Molecular Formula | C17H19F3N2O3S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (3aS,6aR)-2-[[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(Nc1cc(F)ccc1SCC(F)F)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H19F3N2O3S/c18-11-3-4-13(26-8-14(19)20)12(6-11)21-16(25)22-7-10-2-1-5-17(10,9-22)15(23)24/h3-4,6,10,14H,1-2,5,7-9H2,(H,21,25)(H,23,24)/t10-,17+/m0/s1 |
| InChIKey | FMBXXSJAXCYEAW-DYZYQPBXSA-N |
| XLogP | 3.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |