C16H21BrN2O3 — CID 122003095
3-[[1-(4-bromophenyl)cyclopentyl]methylcarbamoylamino]propanoic acid (PubChem CID 122003095) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is 3-[[1-(4-bromophenyl)cyclopentyl]methylcarbamoylamino]propanoic acid.
| Compound Name | 3-[[1-(4-bromophenyl)cyclopentyl]methylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122003095 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-[[1-(4-bromophenyl)cyclopentyl]methylcarbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCC1(c2ccc(Br)cc2)CCCC1 |
| InChI | InChI=1S/C16H21BrN2O3/c17-13-5-3-12(4-6-13)16(8-1-2-9-16)11-19-15(22)18-10-7-14(20)21/h3-6H,1-2,7-11H2,(H,20,21)(H2,18,19,22) |
| InChIKey | BUGBLTLDEZLTJK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |