C13H21F3N2O3S — CID 122004507
(3S,4S)-1-(4-ethylsulfanylbutan-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122004507) has the molecular formula C13H21F3N2O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is (3S,4S)-1-(4-ethylsulfanylbutan-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(4-ethylsulfanylbutan-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122004507 |
| Molecular Formula | C13H21F3N2O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (3S,4S)-1-(4-ethylsulfanylbutan-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCSCCC(C)NC(=O)N1C[C@@H](C(F)(F)F)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H21F3N2O3S/c1-3-22-5-4-8(2)17-12(21)18-6-9(11(19)20)10(7-18)13(14,15)16/h8-10H,3-7H2,1-2H3,(H,17,21)(H,19,20)/t8?,9-,10-/m1/s1 |
| InChIKey | BZZSBXQBUFZLHA-VXRWAFEHSA-N |
| XLogP | 2.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|