C15H24F3N3O4 — CID 122015300
(3S,4S)-1-[2-(2-methylpentanoylamino)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122015300) has the molecular formula C15H24F3N3O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is (3S,4S)-1-[2-(2-methylpentanoylamino)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[2-(2-methylpentanoylamino)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122015300 |
| Molecular Formula | C15H24F3N3O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (3S,4S)-1-[2-(2-methylpentanoylamino)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCC(C)C(=O)NCCNC(=O)N1C[C@@H](C(F)(F)F)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C15H24F3N3O4/c1-3-4-9(2)12(22)19-5-6-20-14(25)21-7-10(13(23)24)11(8-21)15(16,17)18/h9-11H,3-8H2,1-2H3,(H,19,22)(H,20,25)(H,23,24)/t9?,10-,11-/m1/s1 |
| InChIKey | NMDVUQXTLDMISM-FHZGLPGMSA-N |
| XLogP | 1.44 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|