C19H25F3N2O3 — CID 122002631
(3S,4S)-1-[3-(4-propan-2-ylphenyl)propylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122002631) has the molecular formula C19H25F3N2O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is (3S,4S)-1-[3-(4-propan-2-ylphenyl)propylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[3-(4-propan-2-ylphenyl)propylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122002631 |
| Molecular Formula | C19H25F3N2O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (3S,4S)-1-[3-(4-propan-2-ylphenyl)propylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)c1ccc(CCCNC(=O)N2C[C@@H](C(F)(F)F)[C@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C19H25F3N2O3/c1-12(2)14-7-5-13(6-8-14)4-3-9-23-18(27)24-10-15(17(25)26)16(11-24)19(20,21)22/h5-8,12,15-16H,3-4,9-11H2,1-2H3,(H,23,27)(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | KGPUCBQYMBYFEV-HZPDHXFCSA-N |
| XLogP | 3.65 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|