C15H18ClF3N2O3S — CID 122013698
(3S,4S)-1-[4-(5-chlorothiophen-2-yl)butylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122013698) has the molecular formula C15H18ClF3N2O3S and a molecular weight of 398.83 g/mol. Its IUPAC name is (3S,4S)-1-[4-(5-chlorothiophen-2-yl)butylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[4-(5-chlorothiophen-2-yl)butylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122013698 |
| Molecular Formula | C15H18ClF3N2O3S |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (3S,4S)-1-[4-(5-chlorothiophen-2-yl)butylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)NCCCCc2ccc(Cl)s2)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C15H18ClF3N2O3S/c16-12-5-4-9(25-12)3-1-2-6-20-14(24)21-7-10(13(22)23)11(8-21)15(17,18)19/h4-5,10-11H,1-3,6-8H2,(H,20,24)(H,22,23)/t10-,11-/m1/s1 |
| InChIKey | BSTQINQISCVOAC-GHMZBOCLSA-N |
| XLogP | 3.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|