C17H22N4O3 — CID 122004546
3-[[2-(dimethylamino)quinolin-4-yl]methylcarbamoyl-methylamino]propanoic acid (PubChem CID 122004546) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)quinolin-4-yl]methylcarbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[[2-(dimethylamino)quinolin-4-yl]methylcarbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122004546 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-[[2-(dimethylamino)quinolin-4-yl]methylcarbamoyl-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)NCc1cc(N(C)C)nc2ccccc12 |
| InChI | InChI=1S/C17H22N4O3/c1-20(2)15-10-12(13-6-4-5-7-14(13)19-15)11-18-17(24)21(3)9-8-16(22)23/h4-7,10H,8-9,11H2,1-3H3,(H,18,24)(H,22,23) |
| InChIKey | RZPOFDGGSLEUJT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |