C15H19N3 — CID 62279811
4-[(cyclopropylamino)methyl]-N,N-dimethylquinolin-2-amine (PubChem CID 62279811) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]-N,N-dimethylquinolin-2-amine.
| Compound Name | 4-[(cyclopropylamino)methyl]-N,N-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 62279811 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]-N,N-dimethylquinolin-2-amine |
| SMILES | CN(C)c1cc(CNC2CC2)c2ccccc2n1 |
| InChI | InChI=1S/C15H19N3/c1-18(2)15-9-11(10-16-12-7-8-12)13-5-3-4-6-14(13)17-15/h3-6,9,12,16H,7-8,10H2,1-2H3 |
| InChIKey | YMTHAKFCVBZRGU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |