C12H15N3 — CID 56828443
4-(aminomethyl)-N,N-dimethylquinolin-2-amine (PubChem CID 56828443) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-dimethylquinolin-2-amine.
| Compound Name | 4-(aminomethyl)-N,N-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 56828443 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-(aminomethyl)-N,N-dimethylquinolin-2-amine |
| SMILES | CN(C)c1cc(CN)c2ccccc2n1 |
| InChI | InChI=1S/C12H15N3/c1-15(2)12-7-9(8-13)10-5-3-4-6-11(10)14-12/h3-7H,8,13H2,1-2H3 |
| InChIKey | DITYDNHMDFIHEA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |