C12H15N3 — CID 14338127
2-N,2-N,4-N-trimethylquinoline-2,4-diamine (PubChem CID 14338127) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-N,2-N,4-N-trimethylquinoline-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-trimethylquinoline-2,4-diamine |
|---|---|
| PubChem CID | 14338127 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-N,2-N,4-N-trimethylquinoline-2,4-diamine |
| SMILES | CNc1cc(N(C)C)nc2ccccc12 |
| InChI | InChI=1S/C12H15N3/c1-13-11-8-12(15(2)3)14-10-7-5-4-6-9(10)11/h4-8H,1-3H3,(H,13,14) |
| InChIKey | SNKZGOMNKOKYNT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |