C21H25N4O+ — CID 3650696
benzyl-[2-[[2-(dimethylamino)quinolin-4-yl]amino]-2-oxoethyl]-methylazanium (PubChem CID 3650696) has the molecular formula C21H25N4O+ and a molecular weight of 349.46 g/mol. Its IUPAC name is benzyl-[2-[[2-(dimethylamino)quinolin-4-yl]amino]-2-oxoethyl]-methylazanium.
| Compound Name | benzyl-[2-[[2-(dimethylamino)quinolin-4-yl]amino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 3650696 |
| Molecular Formula | C21H25N4O+ |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | benzyl-[2-[[2-(dimethylamino)quinolin-4-yl]amino]-2-oxoethyl]-methylazanium |
| SMILES | CN(C)c1cc(NC(=O)C[NH+](C)Cc2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C21H24N4O/c1-24(2)20-13-19(17-11-7-8-12-18(17)22-20)23-21(26)15-25(3)14-16-9-5-4-6-10-16/h4-13H,14-15H2,1-3H3,(H,22,23,26)/p+1 |
| InChIKey | DUHOHLLLGJRMJH-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |