C24H28N4O5 — CID 16682709
N-[2-(dimethylamino)quinolin-4-yl]-2-(1-phenylpropan-2-ylamino)acetamide;oxalic acid (PubChem CID 16682709) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)quinolin-4-yl]-2-(1-phenylpropan-2-ylamino)acetamide;oxalic acid.
| Compound Name | N-[2-(dimethylamino)quinolin-4-yl]-2-(1-phenylpropan-2-ylamino)acetamide;oxalic acid |
|---|---|
| PubChem CID | 16682709 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[2-(dimethylamino)quinolin-4-yl]-2-(1-phenylpropan-2-ylamino)acetamide;oxalic acid |
| SMILES | CC(Cc1ccccc1)NCC(=O)Nc1cc(N(C)C)nc2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H26N4O.C2H2O4/c1-16(13-17-9-5-4-6-10-17)23-15-22(27)25-20-14-21(26(2)3)24-19-12-8-7-11-18(19)20;3-1(4)2(5)6/h4-12,14,16,23H,13,15H2,1-3H3,(H,24,25,27);(H,3,4)(H,5,6) |
| InChIKey | YEAZUQFQKJLOMB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|