C17H17FN4 — CID 133327888
4-[[(6-fluoro-2-pyridinyl)amino]methyl]-N,N-dimethylquinolin-2-amine (PubChem CID 133327888) has the molecular formula C17H17FN4 and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[[(6-fluoro-2-pyridinyl)amino]methyl]-N,N-dimethylquinolin-2-amine.
| Compound Name | 4-[[(6-fluoro-2-pyridinyl)amino]methyl]-N,N-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 133327888 |
| Molecular Formula | C17H17FN4 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-[[(6-fluoro-2-pyridinyl)amino]methyl]-N,N-dimethylquinolin-2-amine |
| SMILES | CN(C)c1cc(CNc2cccc(F)n2)c2ccccc2n1 |
| InChI | InChI=1S/C17H17FN4/c1-22(2)17-10-12(13-6-3-4-7-14(13)20-17)11-19-16-9-5-8-15(18)21-16/h3-10H,11H2,1-2H3,(H,19,21) |
| InChIKey | NBBMIXIQIVAYFM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|