C21H21N5O — CID 133327923
6-[[2-(dimethylamino)quinolin-4-yl]methylamino]-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 133327923) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-[[2-(dimethylamino)quinolin-4-yl]methylamino]-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 6-[[2-(dimethylamino)quinolin-4-yl]methylamino]-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133327923 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 6-[[2-(dimethylamino)quinolin-4-yl]methylamino]-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(NCc2cc(N(C)C)nc3ccccc23)nc1 |
| InChI | InChI=1S/C21H21N5O/c1-4-11-22-21(27)15-9-10-19(23-13-15)24-14-16-12-20(26(2)3)25-18-8-6-5-7-17(16)18/h1,5-10,12-13H,11,14H2,2-3H3,(H,22,27)(H,23,24) |
| InChIKey | PECTUGLVBLKNQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|