C12H13N3O3 — CID 122049964
(2R)-2-[[5-(prop-2-ynylcarbamoyl)-2-pyridinyl]amino]propanoic acid (PubChem CID 122049964) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2R)-2-[[5-(prop-2-ynylcarbamoyl)-2-pyridinyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[5-(prop-2-ynylcarbamoyl)-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122049964 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (2R)-2-[[5-(prop-2-ynylcarbamoyl)-2-pyridinyl]amino]propanoic acid |
| SMILES | C#CCNC(=O)c1ccc(N[C@H](C)C(=O)O)nc1 |
| InChI | InChI=1S/C12H13N3O3/c1-3-6-13-11(16)9-4-5-10(14-7-9)15-8(2)12(17)18/h1,4-5,7-8H,6H2,2H3,(H,13,16)(H,14,15)(H,17,18)/t8-/m1/s1 |
| InChIKey | VONFKQZAYJGFLT-MRVPVSSYSA-N |
| XLogP | 0.33 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|