C19H28N2O4 — CID 122004761
1-[[1-(2-methoxyphenyl)-3-methylbutyl]carbamoyl]piperidine-4-carboxylic acid (PubChem CID 122004761) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[[1-(2-methoxyphenyl)-3-methylbutyl]carbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[1-(2-methoxyphenyl)-3-methylbutyl]carbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122004761 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[[1-(2-methoxyphenyl)-3-methylbutyl]carbamoyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccccc1C(CC(C)C)NC(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C19H28N2O4/c1-13(2)12-16(15-6-4-5-7-17(15)25-3)20-19(24)21-10-8-14(9-11-21)18(22)23/h4-7,13-14,16H,8-12H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | OIPGLOHHACLUBU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |