C14H22N2O3S2 — CID 122005830
(3aS,6aR)-2-(1,4-dithian-2-ylmethylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122005830) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is (3aS,6aR)-2-(1,4-dithian-2-ylmethylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(1,4-dithian-2-ylmethylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122005830 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (3aS,6aR)-2-(1,4-dithian-2-ylmethylcarbamoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(NCC1CSCCS1)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C14H22N2O3S2/c17-12(18)14-3-1-2-10(14)7-16(9-14)13(19)15-6-11-8-20-4-5-21-11/h10-11H,1-9H2,(H,15,19)(H,17,18)/t10-,11?,14+/m0/s1 |
| InChIKey | VWELQYISGBFPJX-PFSRQVJMSA-N |
| XLogP | 1.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |