About N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide
N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide (PubChem CID 99632792) has the molecular formula C15H26N2OS3
and a molecular weight of 346.59 g/mol. Its IUPAC name is N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide.
Molecular Properties
| Compound Name | N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide |
| PubChem CID | 99632792 |
| Molecular Formula | C15H26N2OS3 |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide |
| SMILES | O=C(NC[C@H]1CSCCS1)N1CCSC2(CCCCC2)C1 |
| InChI | InChI=1S/C15H26N2OS3/c18-14(16-10-13-11-19-8-9-20-13)17-6-7-21-15(12-17)4-2-1-3-5-15/h13H,1-12H2,(H,16,18)/t13-/m0/s1 |
| InChIKey | PARKLLBUVHCMBJ-ZDUSSCGKSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
The IUPAC name of N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide (CID 99632792) is N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide.
What is the SMILES notation for N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
The canonical SMILES for N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide is O=C(NC[C@H]1CSCCS1)N1CCSC2(CCCCC2)C1.
What is the InChIKey of N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
The InChIKey is PARKLLBUVHCMBJ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H26N2OS3/c18-14(16-10-13-11-19-8-9-20-13)17-6-7-21-15(12-17)4-2-1-3-5-15/h13H,1-12H2,(H,16,18)/t13-/m0/s1.
What are the key properties of N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide has a molecular weight of 346.59 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-1,4-dithian-2-yl]methyl]-1-thia-4-azaspiro[5.5]undecane-4-carboxamide is sourced from PubChem (CID 99632792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).