C17H22N4O3 — CID 122005843
4-[[2-(2-phenylethyl)pyrazol-3-yl]methylcarbamoylamino]butanoic acid (PubChem CID 122005843) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-[[2-(2-phenylethyl)pyrazol-3-yl]methylcarbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(2-phenylethyl)pyrazol-3-yl]methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122005843 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-[[2-(2-phenylethyl)pyrazol-3-yl]methylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCc1ccnn1CCc1ccccc1 |
| InChI | InChI=1S/C17H22N4O3/c22-16(23)7-4-10-18-17(24)19-13-15-8-11-20-21(15)12-9-14-5-2-1-3-6-14/h1-3,5-6,8,11H,4,7,9-10,12-13H2,(H,22,23)(H2,18,19,24) |
| InChIKey | NPIMFMDLSKNVAE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|