C17H21N3O3S — CID 122005645
4-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methylcarbamoylamino]butanoic acid (PubChem CID 122005645) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methylcarbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122005645 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCc1csc(CCc2ccccc2)n1 |
| InChI | InChI=1S/C17H21N3O3S/c21-16(22)7-4-10-18-17(23)19-11-14-12-24-15(20-14)9-8-13-5-2-1-3-6-13/h1-3,5-6,12H,4,7-11H2,(H,21,22)(H2,18,19,23) |
| InChIKey | AMFVPOWSJRTRHO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|