C21H28N2O5 — CID 122006370
(3aS,6aR)-2-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122006370) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is (3aS,6aR)-2-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122006370 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (3aS,6aR)-2-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1ccc(CNC(=O)N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)c(OC2CCOC2)c1 |
| InChI | InChI=1S/C21H28N2O5/c1-14-4-5-15(18(9-14)28-17-6-8-27-12-17)10-22-20(26)23-11-16-3-2-7-21(16,13-23)19(24)25/h4-5,9,16-17H,2-3,6-8,10-13H2,1H3,(H,22,26)(H,24,25)/t16-,17?,21+/m0/s1 |
| InChIKey | NEBDLWBMOGENOI-DSSITSQDSA-N |
| XLogP | 2.56 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |