C19H26N6O3 — CID 122006792
2-[ethyl-[3-[1-(1-phenyltriazol-4-yl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122006792) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[ethyl-[3-[1-(1-phenyltriazol-4-yl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[1-(1-phenyltriazol-4-yl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122006792 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[ethyl-[3-[1-(1-phenyltriazol-4-yl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NC(C)c2cn(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C19H26N6O3/c1-3-24(12-18(26)27)16-9-14(10-16)21-19(28)20-13(2)17-11-25(23-22-17)15-7-5-4-6-8-15/h4-8,11,13-14,16H,3,9-10,12H2,1-2H3,(H,26,27)(H2,20,21,28) |
| InChIKey | QZXDKWMEJPVIKO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |