C18H22N4O3 — CID 120674668
4-[1-(1-phenyltriazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120674668) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[1-(1-phenyltriazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[1-(1-phenyltriazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120674668 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-[1-(1-phenyltriazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(NC(=O)C1CCC(C(=O)O)CC1)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C18H22N4O3/c1-12(16-11-22(21-20-16)15-5-3-2-4-6-15)19-17(23)13-7-9-14(10-8-13)18(24)25/h2-6,11-14H,7-10H2,1H3,(H,19,23)(H,24,25) |
| InChIKey | RLOFAINNMZVOIT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |