C16H23N5O — CID 119822438
(2S)-2-amino-4-methyl-N-[1-(1-phenyltriazol-4-yl)ethyl]pentanamide (PubChem CID 119822438) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[1-(1-phenyltriazol-4-yl)ethyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[1-(1-phenyltriazol-4-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 119822438 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[1-(1-phenyltriazol-4-yl)ethyl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NC(C)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C16H23N5O/c1-11(2)9-14(17)16(22)18-12(3)15-10-21(20-19-15)13-7-5-4-6-8-13/h4-8,10-12,14H,9,17H2,1-3H3,(H,18,22)/t12?,14-/m0/s1 |
| InChIKey | KUPJVNOFXSSOER-PYMCNQPYSA-N |
| XLogP | 1.82 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |