C17H26N4O3 — CID 122007131
4-[(1-cyclopentylpyrazol-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122007131) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[(1-cyclopentylpyrazol-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-cyclopentylpyrazol-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122007131 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-[(1-cyclopentylpyrazol-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCc1ccn(C2CCCC2)n1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H26N4O3/c22-16(23)12-5-7-13(8-6-12)19-17(24)18-11-14-9-10-21(20-14)15-3-1-2-4-15/h9-10,12-13,15H,1-8,11H2,(H,22,23)(H2,18,19,24) |
| InChIKey | KWDWJZQSDWAQRW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |