C13H25N3O — CID 171523553
N-[(1-cyclopropylpyrazol-3-yl)methyl]acetamide;ethane (PubChem CID 171523553) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(1-cyclopropylpyrazol-3-yl)methyl]acetamide;ethane.
| Compound Name | N-[(1-cyclopropylpyrazol-3-yl)methyl]acetamide;ethane |
|---|---|
| PubChem CID | 171523553 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N-[(1-cyclopropylpyrazol-3-yl)methyl]acetamide;ethane |
| SMILES | CC.CC.CC(=O)NCc1ccn(C2CC2)n1 |
| InChI | InChI=1S/C9H13N3O.2C2H6/c1-7(13)10-6-8-4-5-12(11-8)9-2-3-9;2*1-2/h4-5,9H,2-3,6H2,1H3,(H,10,13);2*1-2H3 |
| InChIKey | HMKQRBOBRSTGGT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |