C12H21ClN4O — CID 120705188
N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 120705188) has the molecular formula C12H21ClN4O and a molecular weight of 272.78 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120705188 |
| Molecular Formula | C12H21ClN4O |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)NCc1ccn(C2CCCC2)n1.Cl |
| InChI | InChI=1S/C12H20N4O.ClH/c1-13-9-12(17)14-8-10-6-7-16(15-10)11-4-2-3-5-11;/h6-7,11,13H,2-5,8-9H2,1H3,(H,14,17);1H |
| InChIKey | WRWGUZNSKVLTHL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |