C13H20ClN3O2 — CID 103491885
methyl 2-chloro-3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate (PubChem CID 103491885) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is methyl 2-chloro-3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate.
| Compound Name | methyl 2-chloro-3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 103491885 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 2-chloro-3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate |
| SMILES | COC(=O)C(Cl)CNCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C13H20ClN3O2/c1-19-13(18)12(14)9-15-8-10-6-7-17(16-10)11-4-2-3-5-11/h6-7,11-12,15H,2-5,8-9H2,1H3 |
| InChIKey | VPCJTACAZLTFFN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|