C14H23N3O2 — CID 64800694
ethyl 3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate (PubChem CID 64800694) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is ethyl 3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate.
| Compound Name | ethyl 3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 64800694 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | ethyl 3-[(1-cyclopentylpyrazol-3-yl)methylamino]propanoate |
| SMILES | CCOC(=O)CCNCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-19-14(18)7-9-15-11-12-8-10-17(16-12)13-5-3-4-6-13/h8,10,13,15H,2-7,9,11H2,1H3 |
| InChIKey | HGJDDJCVQMPZFN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|