C20H37N3O4 — CID 122010997
2-[[4-[(4-tert-butylcycloheptyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 122010997) has the molecular formula C20H37N3O4 and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[[4-[(4-tert-butylcycloheptyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[(4-tert-butylcycloheptyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 122010997 |
| Molecular Formula | C20H37N3O4 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 2-[[4-[(4-tert-butylcycloheptyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(C(=O)NC2CCCC(C(C)(C)C)CC2)CCO1 |
| InChI | InChI=1S/C20H37N3O4/c1-20(2,3)15-6-5-7-16(9-8-15)21-19(26)23-10-11-27-17(13-23)12-22(4)14-18(24)25/h15-17H,5-14H2,1-4H3,(H,21,26)(H,24,25) |
| InChIKey | ZXUJKULZZNEPGR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |