C14H17FN2O4 — CID 122011176
4-[[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]carbamoylamino]butanoic acid (PubChem CID 122011176) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 4-[[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122011176 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-[[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N[C@H]1CCOc2c(F)cccc21 |
| InChI | InChI=1S/C14H17FN2O4/c15-10-4-1-3-9-11(6-8-21-13(9)10)17-14(20)16-7-2-5-12(18)19/h1,3-4,11H,2,5-8H2,(H,18,19)(H2,16,17,20)/t11-/m0/s1 |
| InChIKey | OWUFUJWLCSAUBO-NSHDSACASA-N |
| XLogP | 1.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|