C20H29N3O3 — CID 122012468
4-[(1-phenylpiperidin-4-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122012468) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[(1-phenylpiperidin-4-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-phenylpiperidin-4-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122012468 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-[(1-phenylpiperidin-4-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCC1CCN(c2ccccc2)CC1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C20H29N3O3/c24-19(25)16-6-8-17(9-7-16)22-20(26)21-14-15-10-12-23(13-11-15)18-4-2-1-3-5-18/h1-5,15-17H,6-14H2,(H,24,25)(H2,21,22,26) |
| InChIKey | RHAXVFQTMKKMSI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |