C16H21N3O3 — CID 122013332
3-[2-(1H-indol-5-yl)ethylcarbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122013332) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[2-(1H-indol-5-yl)ethylcarbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[2-(1H-indol-5-yl)ethylcarbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122013332 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-[2-(1H-indol-5-yl)ethylcarbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)NCCc1ccc2[nH]ccc2c1)C(=O)O |
| InChI | InChI=1S/C16H21N3O3/c1-11(15(20)21)10-19(2)16(22)18-7-5-12-3-4-14-13(9-12)6-8-17-14/h3-4,6,8-9,11,17H,5,7,10H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | IVWXWSHWJHCACO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |