C15H22N2O3 — CID 79757557
2-methyl-3-[methyl-[2-(2-methylphenyl)ethylcarbamoyl]amino]propanoic acid (PubChem CID 79757557) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[2-(2-methylphenyl)ethylcarbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[2-(2-methylphenyl)ethylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 79757557 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-methyl-3-[methyl-[2-(2-methylphenyl)ethylcarbamoyl]amino]propanoic acid |
| SMILES | Cc1ccccc1CCNC(=O)N(C)CC(C)C(=O)O |
| InChI | InChI=1S/C15H22N2O3/c1-11-6-4-5-7-13(11)8-9-16-15(20)17(3)10-12(2)14(18)19/h4-7,12H,8-10H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | XKUQZDIQPPGTFF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |